C9H9NO2S2 — CID 166650846
4-(4-methoxyphenyl)-1,2,4-dithiazolidin-3-one (PubChem CID 166650846) has the molecular formula C9H9NO2S2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1,2,4-dithiazolidin-3-one.
| Compound Name | 4-(4-methoxyphenyl)-1,2,4-dithiazolidin-3-one |
|---|---|
| PubChem CID | 166650846 |
| Molecular Formula | C9H9NO2S2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.01 |
| IUPAC Name | 4-(4-methoxyphenyl)-1,2,4-dithiazolidin-3-one |
| SMILES | COc1ccc(N2CSSC2=O)cc1 |
| InChI | InChI=1S/C9H9NO2S2/c1-12-8-4-2-7(3-5-8)10-6-13-14-9(10)11/h2-5H,6H2,1H3 |
| InChIKey | GLSGCMRNMAPIJI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|