C12H13NO2 — CID 84777227
3-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 84777227) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | 3-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 84777227 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | COc1ccc(N2CC3CC3C2=O)cc1 |
| InChI | InChI=1S/C12H13NO2/c1-15-10-4-2-9(3-5-10)13-7-8-6-11(8)12(13)14/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | WNDPGYRZWJMRQF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |