C22H21NO4 — CID 2939053
4-[4-(4-methoxyphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 2939053) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4-[4-(4-methoxyphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 2939053 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 4-[4-(4-methoxyphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | COc1ccc(Oc2ccc(N3C(=O)C4C5CCC(C5)C4C3=O)cc2)cc1 |
| InChI | InChI=1S/C22H21NO4/c1-26-16-8-10-18(11-9-16)27-17-6-4-15(5-7-17)23-21(24)19-13-2-3-14(12-13)20(19)22(23)25/h4-11,13-14,19-20H,2-3,12H2,1H3 |
| InChIKey | TWTPGOLFZUKYGF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|