C25H27NO3 — CID 2933539
4-[4-(4-tert-butylphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 2933539) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-[4-(4-tert-butylphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4-[4-(4-tert-butylphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 2933539 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 4-[4-(4-tert-butylphenoxy)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(N3C(=O)C4C5CCC(C5)C4C3=O)cc2)cc1 |
| InChI | InChI=1S/C25H27NO3/c1-25(2,3)17-6-10-19(11-7-17)29-20-12-8-18(9-13-20)26-23(27)21-15-4-5-16(14-15)22(21)24(26)28/h6-13,15-16,21-22H,4-5,14H2,1-3H3 |
| InChIKey | XQIAPTDDLNFKGY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|