C13H18N2O2 — CID 117016195
1-(4-methoxyphenyl)-1,4-diazocan-2-one (PubChem CID 117016195) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-1,4-diazocan-2-one.
| Compound Name | 1-(4-methoxyphenyl)-1,4-diazocan-2-one |
|---|---|
| PubChem CID | 117016195 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(4-methoxyphenyl)-1,4-diazocan-2-one |
| SMILES | COc1ccc(N2CCCCNCC2=O)cc1 |
| InChI | InChI=1S/C13H18N2O2/c1-17-12-6-4-11(5-7-12)15-9-3-2-8-14-10-13(15)16/h4-7,14H,2-3,8-10H2,1H3 |
| InChIKey | NYYRVRIOWDQGGT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |