C10H14N2O2 — CID 115101870
1-(5-methylfuran-2-yl)-1,4-diazepan-2-one (PubChem CID 115101870) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-(5-methylfuran-2-yl)-1,4-diazepan-2-one.
| Compound Name | 1-(5-methylfuran-2-yl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 115101870 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-(5-methylfuran-2-yl)-1,4-diazepan-2-one |
| SMILES | Cc1ccc(N2CCCNCC2=O)o1 |
| InChI | InChI=1S/C10H14N2O2/c1-8-3-4-10(14-8)12-6-2-5-11-7-9(12)13/h3-4,11H,2,5-7H2,1H3 |
| InChIKey | QRHVQEWWOKIVPC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |