C12H16N2O — CID 82282881
1-(2-methylphenyl)-1,4-diazepan-2-one (PubChem CID 82282881) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(2-methylphenyl)-1,4-diazepan-2-one.
| Compound Name | 1-(2-methylphenyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 82282881 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-(2-methylphenyl)-1,4-diazepan-2-one |
| SMILES | Cc1ccccc1N1CCCNCC1=O |
| InChI | InChI=1S/C12H16N2O/c1-10-5-2-3-6-11(10)14-8-4-7-13-9-12(14)15/h2-3,5-6,13H,4,7-9H2,1H3 |
| InChIKey | XUVYNGIIUKFJJY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |