C13H17ClN2O — CID 117014427
1-(3-chloro-2-methylphenyl)-1,5-diazocan-2-one (PubChem CID 117014427) has the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-1,5-diazocan-2-one.
| Compound Name | 1-(3-chloro-2-methylphenyl)-1,5-diazocan-2-one |
|---|---|
| PubChem CID | 117014427 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-1,5-diazocan-2-one |
| SMILES | Cc1c(Cl)cccc1N1CCCNCCC1=O |
| InChI | InChI=1S/C13H17ClN2O/c1-10-11(14)4-2-5-12(10)16-9-3-7-15-8-6-13(16)17/h2,4-5,15H,3,6-9H2,1H3 |
| InChIKey | KKVYHLHEGLMVPB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |