C11H13IN2O — CID 130498007
1-(3-iodo-2-methylphenyl)-1,3-diazinan-2-one (PubChem CID 130498007) has the molecular formula C11H13IN2O and a molecular weight of 316.14 g/mol. Its IUPAC name is 1-(3-iodo-2-methylphenyl)-1,3-diazinan-2-one.
| Compound Name | 1-(3-iodo-2-methylphenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 130498007 |
| Molecular Formula | C11H13IN2O |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 1-(3-iodo-2-methylphenyl)-1,3-diazinan-2-one |
| SMILES | Cc1c(I)cccc1N1CCCNC1=O |
| InChI | InChI=1S/C11H13IN2O/c1-8-9(12)4-2-5-10(8)14-7-3-6-13-11(14)15/h2,4-5H,3,6-7H2,1H3,(H,13,15) |
| InChIKey | LVOVOLHMPKHBQC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|