C11H14N2O2 — CID 104549285
1-[2-(hydroxymethyl)phenyl]-1,3-diazinan-2-one (PubChem CID 104549285) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)phenyl]-1,3-diazinan-2-one.
| Compound Name | 1-[2-(hydroxymethyl)phenyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 104549285 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-[2-(hydroxymethyl)phenyl]-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1c1ccccc1CO |
| InChI | InChI=1S/C11H14N2O2/c14-8-9-4-1-2-5-10(9)13-7-3-6-12-11(13)15/h1-2,4-5,14H,3,6-8H2,(H,12,15) |
| InChIKey | SCZXUAFRBDQCSQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |