C11H11IN2O3 — CID 63111688
5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid (PubChem CID 63111688) has the molecular formula C11H11IN2O3 and a molecular weight of 346.12 g/mol. Its IUPAC name is 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid.
| Compound Name | 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid |
|---|---|
| PubChem CID | 63111688 |
| Molecular Formula | C11H11IN2O3 |
| Molecular Weight | 346.12 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid |
| SMILES | O=C(O)c1cc(I)ccc1N1CCCNC1=O |
| InChI | InChI=1S/C11H11IN2O3/c12-7-2-3-9(8(6-7)10(15)16)14-5-1-4-13-11(14)17/h2-3,6H,1,4-5H2,(H,13,17)(H,15,16) |
| InChIKey | LIFDHOSMFXQATO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.12 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|