About 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid
5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid (PubChem CID 63111688) has the molecular formula C11H11IN2O3
and a molecular weight of 346.12 g/mol. Its IUPAC name is 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid.
Molecular Properties
| Compound Name | 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid |
| PubChem CID | 63111688 |
| Molecular Formula | C11H11IN2O3 |
| Molecular Weight | 346.12 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid |
| SMILES | O=C(O)c1cc(I)ccc1N1CCCNC1=O |
| InChI | InChI=1S/C11H11IN2O3/c12-7-2-3-9(8(6-7)10(15)16)14-5-1-4-13-11(14)17/h2-3,6H,1,4-5H2,(H,13,17)(H,15,16) |
| InChIKey | LIFDHOSMFXQATO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.12 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid?
The IUPAC name of 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid (CID 63111688) is 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid.
What is the SMILES notation for 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid?
The canonical SMILES for 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid is O=C(O)c1cc(I)ccc1N1CCCNC1=O.
What is the InChIKey of 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid?
The InChIKey is LIFDHOSMFXQATO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11IN2O3/c12-7-2-3-9(8(6-7)10(15)16)14-5-1-4-13-11(14)17/h2-3,6H,1,4-5H2,(H,13,17)(H,15,16).
What are the key properties of 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid?
5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid has a molecular weight of 346.12 g/mol, XLogP of 1.91, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2-(2-oxo-1,3-diazinan-1-yl)benzoic acid is sourced from PubChem (CID 63111688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).