About 1-(2-benzylphenyl)-1,3-diazinan-2-one
1-(2-benzylphenyl)-1,3-diazinan-2-one (PubChem CID 115370897) has the molecular formula C17H18N2O
and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-(2-benzylphenyl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-(2-benzylphenyl)-1,3-diazinan-2-one |
| PubChem CID | 115370897 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-(2-benzylphenyl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C17H18N2O/c20-17-18-11-6-12-19(17)16-10-5-4-9-15(16)13-14-7-2-1-3-8-14/h1-5,7-10H,6,11-13H2,(H,18,20) |
| InChIKey | JCUUHEXUJDVABH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-benzylphenyl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-benzylphenyl)-1,3-diazinan-2-one?
The IUPAC name of 1-(2-benzylphenyl)-1,3-diazinan-2-one (CID 115370897) is 1-(2-benzylphenyl)-1,3-diazinan-2-one.
What is the SMILES notation for 1-(2-benzylphenyl)-1,3-diazinan-2-one?
The canonical SMILES for 1-(2-benzylphenyl)-1,3-diazinan-2-one is O=C1NCCCN1c1ccccc1Cc1ccccc1.
What is the InChIKey of 1-(2-benzylphenyl)-1,3-diazinan-2-one?
The InChIKey is JCUUHEXUJDVABH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O/c20-17-18-11-6-12-19(17)16-10-5-4-9-15(16)13-14-7-2-1-3-8-14/h1-5,7-10H,6,11-13H2,(H,18,20).
What are the key properties of 1-(2-benzylphenyl)-1,3-diazinan-2-one?
1-(2-benzylphenyl)-1,3-diazinan-2-one has a molecular weight of 266.34 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-benzylphenyl)-1,3-diazinan-2-one is sourced from PubChem (CID 115370897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).