C17H18N2O — CID 115370897
1-(2-benzylphenyl)-1,3-diazinan-2-one (PubChem CID 115370897) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-(2-benzylphenyl)-1,3-diazinan-2-one.
| Compound Name | 1-(2-benzylphenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 115370897 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-(2-benzylphenyl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C17H18N2O/c20-17-18-11-6-12-19(17)16-10-5-4-9-15(16)13-14-7-2-1-3-8-14/h1-5,7-10H,6,11-13H2,(H,18,20) |
| InChIKey | JCUUHEXUJDVABH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |