C10H10F2N2O — CID 115370970
1-(2,3-difluorophenyl)-1,3-diazinan-2-one (PubChem CID 115370970) has the molecular formula C10H10F2N2O and a molecular weight of 212.20 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-1,3-diazinan-2-one.
| Compound Name | 1-(2,3-difluorophenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 115370970 |
| Molecular Formula | C10H10F2N2O |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1-(2,3-difluorophenyl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1c1cccc(F)c1F |
| InChI | InChI=1S/C10H10F2N2O/c11-7-3-1-4-8(9(7)12)14-6-2-5-13-10(14)15/h1,3-4H,2,5-6H2,(H,13,15) |
| InChIKey | BYOAWZNXTQBNQA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |