C12H13F2NO — CID 141144880
1-(2,3-difluorophenyl)azepan-2-one (PubChem CID 141144880) has the molecular formula C12H13F2NO and a molecular weight of 225.24 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)azepan-2-one.
| Compound Name | 1-(2,3-difluorophenyl)azepan-2-one |
|---|---|
| PubChem CID | 141144880 |
| Molecular Formula | C12H13F2NO |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-(2,3-difluorophenyl)azepan-2-one |
| SMILES | O=C1CCCCCN1c1cccc(F)c1F |
| InChI | InChI=1S/C12H13F2NO/c13-9-5-4-6-10(12(9)14)15-8-3-1-2-7-11(15)16/h4-6H,1-3,7-8H2 |
| InChIKey | GZLYSWPFCNNJKH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |