C10H12IN3O — CID 134405874
1-(6-iodo-3-pyridinyl)-1,4-diazepan-2-one (PubChem CID 134405874) has the molecular formula C10H12IN3O and a molecular weight of 317.13 g/mol. Its IUPAC name is 1-(6-iodo-3-pyridinyl)-1,4-diazepan-2-one.
| Compound Name | 1-(6-iodo-3-pyridinyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 134405874 |
| Molecular Formula | C10H12IN3O |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 1-(6-iodo-3-pyridinyl)-1,4-diazepan-2-one |
| SMILES | O=C1CNCCCN1c1ccc(I)nc1 |
| InChI | InChI=1S/C10H12IN3O/c11-9-3-2-8(6-13-9)14-5-1-4-12-7-10(14)15/h2-3,6,12H,1,4-5,7H2 |
| InChIKey | YRUIKJIGQDJOFH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|