C21H23N3O5S — CID 55535426
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 55535426) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 55535426 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 3-(4-methylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(C(=O)Oc3ccc4c(c3)CCC(=O)N4)c2)CC1 |
| InChI | InChI=1S/C21H23N3O5S/c1-23-9-11-24(12-10-23)30(27,28)18-4-2-3-16(14-18)21(26)29-17-6-7-19-15(13-17)5-8-20(25)22-19/h2-4,6-7,13-14H,5,8-12H2,1H3,(H,22,25) |
| InChIKey | GPUQAZIDXHVLHW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|