C21H24N2O5S — CID 9097193
(3,4-dimethylphenyl) 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 9097193) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | (3,4-dimethylphenyl) 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 9097193 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (3,4-dimethylphenyl) 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2cccc(C(=O)Oc3ccc(C)c(C)c3)c2)CC1 |
| InChI | InChI=1S/C21H24N2O5S/c1-15-7-8-19(13-16(15)2)28-21(25)18-5-4-6-20(14-18)29(26,27)23-11-9-22(10-12-23)17(3)24/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | RDRZROIWBFTJRH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|