C15H19N3O6S — CID 7914274
(2-amino-2-oxoethyl) 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 7914274) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | (2-amino-2-oxoethyl) 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 7914274 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2cccc(C(=O)OCC(N)=O)c2)CC1 |
| InChI | InChI=1S/C15H19N3O6S/c1-11(19)17-5-7-18(8-6-17)25(22,23)13-4-2-3-12(9-13)15(21)24-10-14(16)20/h2-4,9H,5-8,10H2,1H3,(H2,16,20) |
| InChIKey | KXFZDNYEFCALGH-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |