C19H26N2O6S — CID 7536796
(3,3-dimethyl-2-oxobutyl) 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate (PubChem CID 7536796) has the molecular formula C19H26N2O6S and a molecular weight of 410.49 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 7536796 |
| Molecular Formula | C19H26N2O6S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 3-(4-acetylpiperazin-1-yl)sulfonylbenzoate |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2cccc(C(=O)OCC(=O)C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C19H26N2O6S/c1-14(22)20-8-10-21(11-9-20)28(25,26)16-7-5-6-15(12-16)18(24)27-13-17(23)19(2,3)4/h5-7,12H,8-11,13H2,1-4H3 |
| InChIKey | WCSSDYUFYNKARS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |