C21H22N2O4S — CID 55488624
6-(4-benzoylpiperidin-1-yl)sulfonyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 55488624) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 6-(4-benzoylpiperidin-1-yl)sulfonyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(4-benzoylpiperidin-1-yl)sulfonyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 55488624 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 6-(4-benzoylpiperidin-1-yl)sulfonyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(S(=O)(=O)N3CCC(C(=O)c4ccccc4)CC3)ccc2N1 |
| InChI | InChI=1S/C21H22N2O4S/c24-20-9-6-17-14-18(7-8-19(17)22-20)28(26,27)23-12-10-16(11-13-23)21(25)15-4-2-1-3-5-15/h1-5,7-8,14,16H,6,9-13H2,(H,22,24) |
| InChIKey | OFKJOYGRZLGDHP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |