C12H15N3O3 — CID 63576489
2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]propanehydrazide (PubChem CID 63576489) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]propanehydrazide.
| Compound Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]propanehydrazide |
|---|---|
| PubChem CID | 63576489 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]propanehydrazide |
| SMILES | CC(Oc1ccc2c(c1)CCC(=O)N2)C(=O)NN |
| InChI | InChI=1S/C12H15N3O3/c1-7(12(17)15-13)18-9-3-4-10-8(6-9)2-5-11(16)14-10/h3-4,6-7H,2,5,13H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | DCTBKJVICBKKLC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|