C23H28N2O3 — CID 13200337
N-butyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-phenylbutanamide (PubChem CID 13200337) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-butyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-phenylbutanamide.
| Compound Name | N-butyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-phenylbutanamide |
|---|---|
| PubChem CID | 13200337 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-butyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-phenylbutanamide |
| SMILES | CCCCN(C(=O)CCCOc1ccc2c(c1)CCC(=O)N2)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O3/c1-2-3-15-25(19-8-5-4-6-9-19)23(27)10-7-16-28-20-12-13-21-18(17-20)11-14-22(26)24-21/h4-6,8-9,12-13,17H,2-3,7,10-11,14-16H2,1H3,(H,24,26) |
| InChIKey | VWCNXDXKHJCTCM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|