C21H28N2O5 — CID 120539489
1-[methyl-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 120539489) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is 1-[methyl-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[methyl-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120539489 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[methyl-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CN(C(=O)CCCOc1ccc2c(c1)CCC(=O)N2)C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C21H28N2O5/c1-23(21(20(26)27)11-3-2-4-12-21)19(25)6-5-13-28-16-8-9-17-15(14-16)7-10-18(24)22-17/h8-9,14H,2-7,10-13H2,1H3,(H,22,24)(H,26,27) |
| InChIKey | JFWZMLHGLNGLST-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|