C22H26N2O4 — CID 31905955
N-methyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-(2-phenoxyethyl)butanamide (PubChem CID 31905955) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-methyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-(2-phenoxyethyl)butanamide.
| Compound Name | N-methyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-(2-phenoxyethyl)butanamide |
|---|---|
| PubChem CID | 31905955 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-methyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-(2-phenoxyethyl)butanamide |
| SMILES | CN(CCOc1ccccc1)C(=O)CCCOc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C22H26N2O4/c1-24(13-15-28-18-6-3-2-4-7-18)22(26)8-5-14-27-19-10-11-20-17(16-19)9-12-21(25)23-20/h2-4,6-7,10-11,16H,5,8-9,12-15H2,1H3,(H,23,25) |
| InChIKey | IGTLKVJLFSXXLJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|