C24H27ClN2O3 — CID 78852822
N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide (PubChem CID 78852822) has the molecular formula C24H27ClN2O3 and a molecular weight of 426.94 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide |
|---|---|
| PubChem CID | 78852822 |
| Molecular Formula | C24H27ClN2O3 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide |
| SMILES | CC(c1ccc(Cl)cc1)N(C(=O)CCCOc1ccc2c(c1)CCC(=O)N2)C1CC1 |
| InChI | InChI=1S/C24H27ClN2O3/c1-16(17-4-7-19(25)8-5-17)27(20-9-10-20)24(29)3-2-14-30-21-11-12-22-18(15-21)6-13-23(28)26-22/h4-5,7-8,11-12,15-16,20H,2-3,6,9-10,13-14H2,1H3,(H,26,28) |
| InChIKey | UTFXFVFBBREJTC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|