C18H24N2O5 — CID 119199653
2-methyl-2-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]butanoic acid (PubChem CID 119199653) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-methyl-2-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]butanoic acid.
| Compound Name | 2-methyl-2-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]butanoic acid |
|---|---|
| PubChem CID | 119199653 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-methyl-2-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]butanoic acid |
| SMILES | CCC(C)(NC(=O)CCCOc1ccc2c(c1)CCC(=O)N2)C(=O)O |
| InChI | InChI=1S/C18H24N2O5/c1-3-18(2,17(23)24)20-16(22)5-4-10-25-13-7-8-14-12(11-13)6-9-15(21)19-14/h7-8,11H,3-6,9-10H2,1-2H3,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | JEIBPTNHTQBBCA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|