C33H41FO4 — CID 54580084
[(2Z)-2-[(4-fluorophenyl)methylidene]-3-oxo-1-benzofuran-5-yl] (Z)-octadec-9-enoate (PubChem CID 54580084) has the molecular formula C33H41FO4 and a molecular weight of 520.69 g/mol. Its IUPAC name is [(2Z)-2-[(4-fluorophenyl)methylidene]-3-oxo-1-benzofuran-5-yl] (Z)-octadec-9-enoate.
| Compound Name | [(2Z)-2-[(4-fluorophenyl)methylidene]-3-oxo-1-benzofuran-5-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 54580084 |
| Molecular Formula | C33H41FO4 |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | [(2Z)-2-[(4-fluorophenyl)methylidene]-3-oxo-1-benzofuran-5-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Oc1ccc2c(c1)C(=O)/C(=C/c1ccc(F)cc1)O2 |
| InChI | InChI=1S/C33H41FO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-32(35)37-28-22-23-30-29(25-28)33(36)31(38-30)24-26-18-20-27(34)21-19-26/h9-10,18-25H,2-8,11-17H2,1H3/b10-9-,31-24- |
| InChIKey | TVGKXMZJIQQVKB-ZRNDDZBHSA-N |
| XLogP | 9.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|