C34H44O4 — CID 54586939
[(2Z)-2-[(4-methoxyphenyl)methylidene]-3H-1-benzofuran-6-yl] (10E,12Z)-octadeca-10,12-dienoate (PubChem CID 54586939) has the molecular formula C34H44O4 and a molecular weight of 516.72 g/mol. Its IUPAC name is [(2Z)-2-[(4-methoxyphenyl)methylidene]-3H-1-benzofuran-6-yl] (10E,12Z)-octadeca-10,12-dienoate.
| Compound Name | [(2Z)-2-[(4-methoxyphenyl)methylidene]-3H-1-benzofuran-6-yl] (10E,12Z)-octadeca-10,12-dienoate |
|---|---|
| PubChem CID | 54586939 |
| Molecular Formula | C34H44O4 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | [(2Z)-2-[(4-methoxyphenyl)methylidene]-3H-1-benzofuran-6-yl] (10E,12Z)-octadeca-10,12-dienoate |
| SMILES | CCCCC/C=C\C=C\CCCCCCCCC(=O)Oc1ccc2c(c1)O/C(=C\c1ccc(OC)cc1)C2 |
| InChI | InChI=1S/C34H44O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-34(35)38-31-24-21-29-26-32(37-33(29)27-31)25-28-19-22-30(36-2)23-20-28/h7-10,19-25,27H,3-6,11-18,26H2,1-2H3/b8-7-,10-9+,32-25- |
| InChIKey | BJJYFVOGKKNJHB-HLMZYKILSA-N |
| XLogP | 9.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|