C36H57N3O3 — CID 121367034
[(8S,9S,13S,14S)-8,9,14-triamino-13-methyl-17-oxo-6,7,11,12,15,16-hexahydrocyclopenta[a]phenanthren-3-yl] (Z)-octadec-9-enoate (PubChem CID 121367034) has the molecular formula C36H57N3O3 and a molecular weight of 579.87 g/mol. Its IUPAC name is [(8S,9S,13S,14S)-8,9,14-triamino-13-methyl-17-oxo-6,7,11,12,15,16-hexahydrocyclopenta[a]phenanthren-3-yl] (Z)-octadec-9-enoate.
| Compound Name | [(8S,9S,13S,14S)-8,9,14-triamino-13-methyl-17-oxo-6,7,11,12,15,16-hexahydrocyclopenta[a]phenanthren-3-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 121367034 |
| Molecular Formula | C36H57N3O3 |
| Molecular Weight | 579.87 g/mol |
| Exact Mass | 579.44 |
| IUPAC Name | [(8S,9S,13S,14S)-8,9,14-triamino-13-methyl-17-oxo-6,7,11,12,15,16-hexahydrocyclopenta[a]phenanthren-3-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Oc1ccc2c(c1)CC[C@@]1(N)[C@]3(N)CCC(=O)[C@@]3(C)CC[C@]21N |
| InChI | InChI=1S/C36H57N3O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-32(41)42-29-19-20-30-28(27-29)21-23-36(39)34(30,37)26-25-33(2)31(40)22-24-35(33,36)38/h10-11,19-20,27H,3-9,12-18,21-26,37-39H2,1-2H3/b11-10-/t33-,34+,35+,36+/m1/s1 |
| InChIKey | CIDPSSGPGNCKRC-BCQMYZFTSA-N |
| XLogP | 7.29 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.87 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|