C27H43NO4 — CID 174987369
2-amino-3-[4-[(Z)-octadec-9-enoyl]oxyphenyl]propanoic acid (PubChem CID 174987369) has the molecular formula C27H43NO4 and a molecular weight of 445.64 g/mol. Its IUPAC name is 2-amino-3-[4-[(Z)-octadec-9-enoyl]oxyphenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[(Z)-octadec-9-enoyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 174987369 |
| Molecular Formula | C27H43NO4 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | 2-amino-3-[4-[(Z)-octadec-9-enoyl]oxyphenyl]propanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Oc1ccc(CC(N)C(=O)O)cc1 |
| InChI | InChI=1S/C27H43NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-26(29)32-24-20-18-23(19-21-24)22-25(28)27(30)31/h9-10,18-21,25H,2-8,11-17,22,28H2,1H3,(H,30,31)/b10-9- |
| InChIKey | HZZPXXJHNMNQDC-KTKRTIGZSA-N |
| XLogP | 6.58 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|