C14H19NO4 — CID 142661871
(2S)-2-amino-3-[4-(3-methylbutanoyloxy)phenyl]propanoic acid (PubChem CID 142661871) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-(3-methylbutanoyloxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-(3-methylbutanoyloxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 142661871 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2S)-2-amino-3-[4-(3-methylbutanoyloxy)phenyl]propanoic acid |
| SMILES | CC(C)CC(=O)Oc1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO4/c1-9(2)7-13(16)19-11-5-3-10(4-6-11)8-12(15)14(17)18/h3-6,9,12H,7-8,15H2,1-2H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | OVGQJRDRZNCBST-LBPRGKRZSA-N |
| XLogP | 1.59 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|