C17H15NO6 — CID 70664290
2-[4-[(2S)-2-amino-2-carboxyethyl]phenoxy]carbonylbenzoic acid (PubChem CID 70664290) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-[4-[(2S)-2-amino-2-carboxyethyl]phenoxy]carbonylbenzoic acid.
| Compound Name | 2-[4-[(2S)-2-amino-2-carboxyethyl]phenoxy]carbonylbenzoic acid |
|---|---|
| PubChem CID | 70664290 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-[4-[(2S)-2-amino-2-carboxyethyl]phenoxy]carbonylbenzoic acid |
| SMILES | N[C@@H](Cc1ccc(OC(=O)c2ccccc2C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C17H15NO6/c18-14(16(21)22)9-10-5-7-11(8-6-10)24-17(23)13-4-2-1-3-12(13)15(19)20/h1-8,14H,9,18H2,(H,19,20)(H,21,22)/t14-/m0/s1 |
| InChIKey | HDJTWGNOIXGIMN-AWEZNQCLSA-N |
| XLogP | 1.56 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|