C11H12ClNO5 — CID 66562275
(2R)-2-amino-3-[4-(chloromethoxycarbonyloxy)phenyl]propanoic acid (PubChem CID 66562275) has the molecular formula C11H12ClNO5 and a molecular weight of 273.67 g/mol. Its IUPAC name is (2R)-2-amino-3-[4-(chloromethoxycarbonyloxy)phenyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[4-(chloromethoxycarbonyloxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 66562275 |
| Molecular Formula | C11H12ClNO5 |
| Molecular Weight | 273.67 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | (2R)-2-amino-3-[4-(chloromethoxycarbonyloxy)phenyl]propanoic acid |
| SMILES | N[C@H](Cc1ccc(OC(=O)OCCl)cc1)C(=O)O |
| InChI | InChI=1S/C11H12ClNO5/c12-6-17-11(16)18-8-3-1-7(2-4-8)5-9(13)10(14)15/h1-4,9H,5-6,13H2,(H,14,15)/t9-/m1/s1 |
| InChIKey | ANVWVMSMDZIWRG-SECBINFHSA-N |
| XLogP | 1.35 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.67 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|