C42H47N3O18 — CID 146580216
(2S)-2-amino-3-[4-[4-[2,3-bis[[4-[4-[(2S)-2-amino-2-carboxyethyl]phenoxy]-4-oxobutanoyl]oxy]propoxy]-4-oxobutanoyl]oxyphenyl]propanoic acid (PubChem CID 146580216) has the molecular formula C42H47N3O18 and a molecular weight of 881.84 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[4-[2,3-bis[[4-[4-[(2S)-2-amino-2-carboxyethyl]phenoxy]-4-oxobutanoyl]oxy]propoxy]-4-oxobutanoyl]oxyphenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[4-[2,3-bis[[4-[4-[(2S)-2-amino-2-carboxyethyl]phenoxy]-4-oxobutanoyl]oxy]propoxy]-4-oxobutanoyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 146580216 |
| Molecular Formula | C42H47N3O18 |
| Molecular Weight | 881.84 g/mol |
| Exact Mass | 881.29 |
| IUPAC Name | (2S)-2-amino-3-[4-[4-[2,3-bis[[4-[4-[(2S)-2-amino-2-carboxyethyl]phenoxy]-4-oxobutanoyl]oxy]propoxy]-4-oxobutanoyl]oxyphenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(OC(=O)CCC(=O)OCC(COC(=O)CCC(=O)Oc2ccc(C[C@H](N)C(=O)O)cc2)OC(=O)CCC(=O)Oc2ccc(C[C@H](N)C(=O)O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C42H47N3O18/c43-31(40(52)53)19-24-1-7-27(8-2-24)60-36(48)15-13-34(46)58-22-30(63-39(51)18-17-38(50)62-29-11-5-26(6-12-29)21-33(45)42(56)57)23-59-35(47)14-16-37(49)61-28-9-3-25(4-10-28)20-32(44)41(54)55/h1-12,30-33H,13-23,43-45H2,(H,52,53)(H,54,55)(H,56,57)/t31-,32-,33-/m0/s1 |
| InChIKey | OSURDIHIJWNLDS-ZDCRTTOTSA-N |
| XLogP | 1.01 |
| TPSA | 347.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.84 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|