C27H43NO3 — CID 118354702
(2-amino-3-phenylpropanoyl) (Z)-octadec-9-enoate (PubChem CID 118354702) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is (2-amino-3-phenylpropanoyl) (Z)-octadec-9-enoate.
| Compound Name | (2-amino-3-phenylpropanoyl) (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 118354702 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | (2-amino-3-phenylpropanoyl) (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C27H43NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-26(29)31-27(30)25(28)23-24-20-17-16-18-21-24/h9-10,16-18,20-21,25H,2-8,11-15,19,22-23,28H2,1H3/b10-9- |
| InChIKey | GPOJSONJTHCNQR-KTKRTIGZSA-N |
| XLogP | 6.66 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|