C21H37NO4 — CID 168953351
[(2S)-2-amino-3-hydroxypropanoyl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 168953351) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is [(2S)-2-amino-3-hydroxypropanoyl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(2S)-2-amino-3-hydroxypropanoyl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 168953351 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | [(2S)-2-amino-3-hydroxypropanoyl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(=O)[C@@H](N)CO |
| InChI | InChI=1S/C21H37NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)26-21(25)19(22)18-23/h6-7,9-10,19,23H,2-5,8,11-18,22H2,1H3/b7-6-,10-9-/t19-/m0/s1 |
| InChIKey | LBZSBXLNKBFRNK-YRUZJVEHSA-N |
| XLogP | 4.19 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|