About [(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate
[(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate (PubChem CID 168953345) has the molecular formula C21H39NO4
and a molecular weight of 369.55 g/mol. Its IUPAC name is [(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate.
Molecular Properties
| Compound Name | [(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate |
| PubChem CID | 168953345 |
| Molecular Formula | C21H39NO4 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | [(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate |
| SMILES | CCCCCC/C=C/CCCCCCCCCC(=O)OC(=O)[C@@H](N)CO |
| InChI | InChI=1S/C21H39NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)26-21(25)19(22)18-23/h7-8,19,23H,2-6,9-18,22H2,1H3/b8-7+/t19-/m0/s1 |
| InChIKey | KMNSXLGZMYWFDV-UCFODXPJSA-N |
| XLogP | 4.41 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate?
The IUPAC name of [(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate (CID 168953345) is [(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate.
What is the SMILES notation for [(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate?
The canonical SMILES for [(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate is CCCCCC/C=C/CCCCCCCCCC(=O)OC(=O)[C@@H](N)CO.
What is the InChIKey of [(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate?
The InChIKey is KMNSXLGZMYWFDV-UCFODXPJSA-N. The full InChI is InChI=1S/C21H39NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)26-21(25)19(22)18-23/h7-8,19,23H,2-6,9-18,22H2,1H3/b8-7+/t19-/m0/s1.
What are the key properties of [(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate?
[(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate has a molecular weight of 369.55 g/mol, XLogP of 4.41, 17 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-amino-3-hydroxypropanoyl] (E)-octadec-11-enoate is sourced from PubChem (CID 168953345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).