About calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate
calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate (PubChem CID 174485858) has the molecular formula C21H40CaO4
and a molecular weight of 396.63 g/mol. Its IUPAC name is calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate |
| PubChem CID | 174485858 |
| Molecular Formula | C21H40CaO4 |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(=O)C(C)O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C21H38O4.Ca.2H/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(23)25-21(24)19(2)22;;;/h10-11,19,22H,3-9,12-18H2,1-2H3;;;/q;+2;2*-1/b11-10-;;; |
| InChIKey | CORDRAIHUBINTK-RVVQQURLSA-N |
| XLogP | 5.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate?
The IUPAC name of calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate (CID 174485858) is calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate.
What is the SMILES notation for calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate?
The canonical SMILES for calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OC(=O)C(C)O.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate?
The InChIKey is CORDRAIHUBINTK-RVVQQURLSA-N. The full InChI is InChI=1S/C21H38O4.Ca.2H/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(23)25-21(24)19(2)22;;;/h10-11,19,22H,3-9,12-18H2,1-2H3;;;/q;+2;2*-1/b11-10-;;;.
What are the key properties of calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate?
calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate has a molecular weight of 396.63 g/mol, XLogP of 5.32, 16 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;2-hydroxypropanoyl (Z)-octadec-9-enoate is sourced from PubChem (CID 174485858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).