C23H40NNaO5 — CID 140782213
sodium (4S)-4-amino-5-[(Z)-octadec-9-enoyl]oxy-5-oxopentanoate (PubChem CID 140782213) has the molecular formula C23H40NNaO5 and a molecular weight of 433.57 g/mol. Its IUPAC name is sodium (4S)-4-amino-5-[(Z)-octadec-9-enoyl]oxy-5-oxopentanoate.
| Compound Name | sodium (4S)-4-amino-5-[(Z)-octadec-9-enoyl]oxy-5-oxopentanoate |
|---|---|
| PubChem CID | 140782213 |
| Molecular Formula | C23H40NNaO5 |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | sodium (4S)-4-amino-5-[(Z)-octadec-9-enoyl]oxy-5-oxopentanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(=O)[C@@H](N)CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C23H41NO5.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(27)29-23(28)20(24)18-19-21(25)26;/h9-10,20H,2-8,11-19,24H2,1H3,(H,25,26);/q;+1/p-1/b10-9-;/t20-;/m0./s1 |
| InChIKey | MJEDOEULIFVNBP-LZUSKFISSA-M |
| XLogP | 0.96 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|