C19H34NNaO5 — CID 57349620
sodium (4S)-4-amino-5-oxo-5-tetradecanoyloxypentanoate (PubChem CID 57349620) has the molecular formula C19H34NNaO5 and a molecular weight of 379.47 g/mol. Its IUPAC name is sodium (4S)-4-amino-5-oxo-5-tetradecanoyloxypentanoate.
| Compound Name | sodium (4S)-4-amino-5-oxo-5-tetradecanoyloxypentanoate |
|---|---|
| PubChem CID | 57349620 |
| Molecular Formula | C19H34NNaO5 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | sodium (4S)-4-amino-5-oxo-5-tetradecanoyloxypentanoate |
| SMILES | CCCCCCCCCCCCCC(=O)OC(=O)[C@@H](N)CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C19H35NO5.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-18(23)25-19(24)16(20)14-15-17(21)22;/h16H,2-15,20H2,1H3,(H,21,22);/q;+1/p-1/t16-;/m0./s1 |
| InChIKey | MEPWGWOLTUCULL-NTISSMGPSA-M |
| XLogP | -0.38 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|