C22H42KNO8 — CID 174756989
potassium;4-amino-5-oxo-5-tetradecanoyloxypentanoate;propane-1,2,3-triol (PubChem CID 174756989) has the molecular formula C22H42KNO8 and a molecular weight of 487.68 g/mol. Its IUPAC name is potassium;4-amino-5-oxo-5-tetradecanoyloxypentanoate;propane-1,2,3-triol.
| Compound Name | potassium;4-amino-5-oxo-5-tetradecanoyloxypentanoate;propane-1,2,3-triol |
|---|---|
| PubChem CID | 174756989 |
| Molecular Formula | C22H42KNO8 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | potassium;4-amino-5-oxo-5-tetradecanoyloxypentanoate;propane-1,2,3-triol |
| SMILES | CCCCCCCCCCCCCC(=O)OC(=O)C(N)CCC(=O)[O-].OCC(O)CO.[K+] |
| InChI | InChI=1S/C19H35NO5.C3H8O3.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-18(23)25-19(24)16(20)14-15-17(21)22;4-1-3(6)2-5;/h16H,2-15,20H2,1H3,(H,21,22);3-6H,1-2H2;/q;;+1/p-1 |
| InChIKey | PUZIDCFVPUCENW-UHFFFAOYSA-M |
| XLogP | -2.05 |
| TPSA | 170.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|