C15H23BN2O3 — CID 164643922
1-methyl-3-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]urea (PubChem CID 164643922) has the molecular formula C15H23BN2O3 and a molecular weight of 290.17 g/mol. Its IUPAC name is 1-methyl-3-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]urea.
| Compound Name | 1-methyl-3-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 164643922 |
| Molecular Formula | C15H23BN2O3 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-methyl-3-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]urea |
| SMILES | CNC(=O)NCc1ccccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H23BN2O3/c1-14(2)15(3,4)21-16(20-14)12-9-7-6-8-11(12)10-18-13(19)17-5/h6-9H,10H2,1-5H3,(H2,17,18,19) |
| InChIKey | NWUVYMQELHMENE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|