C21H34BFO2 — CID 155733776
2-(2-fluoro-3-nonylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 155733776) has the molecular formula C21H34BFO2 and a molecular weight of 348.31 g/mol. Its IUPAC name is 2-(2-fluoro-3-nonylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(2-fluoro-3-nonylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 155733776 |
| Molecular Formula | C21H34BFO2 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | 2-(2-fluoro-3-nonylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCCc1cccc(B2OC(C)(C)C(C)(C)O2)c1F |
| InChI | InChI=1S/C21H34BFO2/c1-6-7-8-9-10-11-12-14-17-15-13-16-18(19(17)23)22-24-20(2,3)21(4,5)25-22/h13,15-16H,6-12,14H2,1-5H3 |
| InChIKey | QIOJYONYMGGCNF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|