C22H35BO2 — CID 11313863
2-(3-hexyl-5,6,7,8-tetrahydronaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 11313863) has the molecular formula C22H35BO2 and a molecular weight of 342.33 g/mol. Its IUPAC name is 2-(3-hexyl-5,6,7,8-tetrahydronaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3-hexyl-5,6,7,8-tetrahydronaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 11313863 |
| Molecular Formula | C22H35BO2 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | 2-(3-hexyl-5,6,7,8-tetrahydronaphthalen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCc1cc2c(cc1B1OC(C)(C)C(C)(C)O1)CCCC2 |
| InChI | InChI=1S/C22H35BO2/c1-6-7-8-9-14-19-15-17-12-10-11-13-18(17)16-20(19)23-24-21(2,3)22(4,5)25-23/h15-16H,6-14H2,1-5H3 |
| InChIKey | UHRIVRHMXIXYQW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|