C16H24 — CID 59068050
4-deuterio-6-hexyl-5-methyl-2,3-dihydro-1H-indene (PubChem CID 59068050) has the molecular formula C16H24 and a molecular weight of 217.37 g/mol. Its IUPAC name is 4-deuterio-6-hexyl-5-methyl-2,3-dihydro-1H-indene.
| Compound Name | 4-deuterio-6-hexyl-5-methyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 59068050 |
| Molecular Formula | C16H24 |
| Molecular Weight | 217.37 g/mol |
| Exact Mass | 217.19 |
| IUPAC Name | 4-deuterio-6-hexyl-5-methyl-2,3-dihydro-1H-indene |
| SMILES | [2H]c1c(C)c(CCCCCC)cc2c1CCC2 |
| InChI | InChI=1S/C16H24/c1-3-4-5-6-8-14-12-16-10-7-9-15(16)11-13(14)2/h11-12H,3-10H2,1-2H3/i11D |
| InChIKey | ZGKAXQBBPFDONE-WORMITQPSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|