About 4,6-dibutyl-2,3-dihydro-1H-inden-5-ol
4,6-dibutyl-2,3-dihydro-1H-inden-5-ol (PubChem CID 154132660) has the molecular formula C17H26O
and a molecular weight of 246.39 g/mol. Its IUPAC name is 4,6-dibutyl-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | 4,6-dibutyl-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 154132660 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 4,6-dibutyl-2,3-dihydro-1H-inden-5-ol |
| SMILES | CCCCc1cc2c(c(CCCC)c1O)CCC2 |
| InChI | InChI=1S/C17H26O/c1-3-5-8-14-12-13-9-7-11-15(13)16(17(14)18)10-6-4-2/h12,18H,3-11H2,1-2H3 |
| InChIKey | QXLZUVGBISGSEK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,6-dibutyl-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dibutyl-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of 4,6-dibutyl-2,3-dihydro-1H-inden-5-ol (CID 154132660) is 4,6-dibutyl-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for 4,6-dibutyl-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for 4,6-dibutyl-2,3-dihydro-1H-inden-5-ol is CCCCc1cc2c(c(CCCC)c1O)CCC2.
What is the InChIKey of 4,6-dibutyl-2,3-dihydro-1H-inden-5-ol?
The InChIKey is QXLZUVGBISGSEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O/c1-3-5-8-14-12-13-9-7-11-15(13)16(17(14)18)10-6-4-2/h12,18H,3-11H2,1-2H3.
What are the key properties of 4,6-dibutyl-2,3-dihydro-1H-inden-5-ol?
4,6-dibutyl-2,3-dihydro-1H-inden-5-ol has a molecular weight of 246.39 g/mol, XLogP of 4.57, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dibutyl-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 154132660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).