C15H22NdO3 — CID 150864934
4,6-dibutyl-1,3-benzodioxol-5-ol;neodymium (PubChem CID 150864934) has the molecular formula C15H22NdO3 and a molecular weight of 394.58 g/mol. Its IUPAC name is 4,6-dibutyl-1,3-benzodioxol-5-ol;neodymium.
| Compound Name | 4,6-dibutyl-1,3-benzodioxol-5-ol;neodymium |
|---|---|
| PubChem CID | 150864934 |
| Molecular Formula | C15H22NdO3 |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 4,6-dibutyl-1,3-benzodioxol-5-ol;neodymium |
| SMILES | CCCCc1cc2c(c(CCCC)c1O)OCO2.[Nd] |
| InChI | InChI=1S/C15H22O3.Nd/c1-3-5-7-11-9-13-15(18-10-17-13)12(14(11)16)8-6-4-2;/h9,16H,3-8,10H2,1-2H3; |
| InChIKey | VFNBYXYVXWNYNZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |