C15H20 — CID 142529485
4-propyl-1,2,3,5,6,7-hexahydro-s-indacene (PubChem CID 142529485) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 4-propyl-1,2,3,5,6,7-hexahydro-s-indacene.
| Compound Name | 4-propyl-1,2,3,5,6,7-hexahydro-s-indacene |
|---|---|
| PubChem CID | 142529485 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 4-propyl-1,2,3,5,6,7-hexahydro-s-indacene |
| SMILES | CCCc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C15H20/c1-2-5-15-13-8-3-6-11(13)10-12-7-4-9-14(12)15/h10H,2-9H2,1H3 |
| InChIKey | DVNJORMLGCJDIA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |