C14H16NNaO — CID 175793204
sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide (PubChem CID 175793204) has the molecular formula C14H16NNaO and a molecular weight of 237.28 g/mol. Its IUPAC name is sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide.
| Compound Name | sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide |
|---|---|
| PubChem CID | 175793204 |
| Molecular Formula | C14H16NNaO |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide |
| SMILES | [NH-]C(=O)Cc1c2c(cc3c1CCC3)CCC2.[Na+] |
| InChI | InChI=1S/C14H17NO.Na/c15-14(16)8-13-11-5-1-3-9(11)7-10-4-2-6-12(10)13;/h7H,1-6,8H2,(H2,15,16);/q;+1/p-1 |
| InChIKey | XFYQSIFAAWUWOT-UHFFFAOYSA-M |
| XLogP | -0.21 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |