sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide

C14H16NNaO — CID 175793204

IUPACsodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide
SMILES[NH-]C(=O)Cc1c2c(cc3c1CCC3)CCC2.[Na+]
InChIInChI=1S/C14H17NO.Na/c15-14(16)8-13-11-5-1-3-9(11)7-10-4-2-6-12(10)13;/h7H,1-6,8H2,(H2,15,16);/q;+1/p-1
InChIKeyXFYQSIFAAWUWOT-UHFFFAOYSA-M
MW237.28 g/mol
LogP-0.21
Rot. Bonds2

About sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide

sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide (PubChem CID 175793204) has the molecular formula C14H16NNaO and a molecular weight of 237.28 g/mol. Its IUPAC name is sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide.

Molecular Properties

Compound Namesodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide
PubChem CID175793204
Molecular FormulaC14H16NNaO
Molecular Weight237.28 g/mol
Exact Mass237.11
IUPAC Namesodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide
SMILES[NH-]C(=O)Cc1c2c(cc3c1CCC3)CCC2.[Na+]
InChIInChI=1S/C14H17NO.Na/c15-14(16)8-13-11-5-1-3-9(11)7-10-4-2-6-12(10)13;/h7H,1-6,8H2,(H2,15,16);/q;+1/p-1
InChIKeyXFYQSIFAAWUWOT-UHFFFAOYSA-M
XLogP-0.21
TPSA40.87 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.28
LogP ≤ 5-0.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Analyze sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide?
The IUPAC name of sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide (CID 175793204) is sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide.
What is the SMILES notation for sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide?
The canonical SMILES for sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide is [NH-]C(=O)Cc1c2c(cc3c1CCC3)CCC2.[Na+].
What is the InChIKey of sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide?
The InChIKey is XFYQSIFAAWUWOT-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H17NO.Na/c15-14(16)8-13-11-5-1-3-9(11)7-10-4-2-6-12(10)13;/h7H,1-6,8H2,(H2,15,16);/q;+1/p-1.
What are the key properties of sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide?
sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide has a molecular weight of 237.28 g/mol, XLogP of -0.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium [2-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)acetyl]azanide is sourced from PubChem (CID 175793204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).