2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride

C12H11ClO — CID 155390015

IUPAC2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride
SMILESO=C(Cl)Cc1c2c(cc3c1CC3)CC2
InChIInChI=1S/C12H11ClO/c13-12(14)6-11-9-3-1-7(9)5-8-2-4-10(8)11/h5H,1-4,6H2
InChIKeyVXPXHFRSWYCPCK-UHFFFAOYSA-N
MW206.67 g/mol
LogP2.19
Rot. Bonds2

About 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride

2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride (PubChem CID 155390015) has the molecular formula C12H11ClO and a molecular weight of 206.67 g/mol. Its IUPAC name is 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride.

Molecular Properties

Compound Name2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride
PubChem CID155390015
Molecular FormulaC12H11ClO
Molecular Weight206.67 g/mol
Exact Mass206.05
IUPAC Name2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride
SMILESO=C(Cl)Cc1c2c(cc3c1CC3)CC2
InChIInChI=1S/C12H11ClO/c13-12(14)6-11-9-3-1-7(9)5-8-2-4-10(8)11/h5H,1-4,6H2
InChIKeyVXPXHFRSWYCPCK-UHFFFAOYSA-N
XLogP2.19
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.67
LogP ≤ 52.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride?
The IUPAC name of 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride (CID 155390015) is 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride.
What is the SMILES notation for 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride?
The canonical SMILES for 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride is O=C(Cl)Cc1c2c(cc3c1CC3)CC2.
What is the InChIKey of 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride?
The InChIKey is VXPXHFRSWYCPCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClO/c13-12(14)6-11-9-3-1-7(9)5-8-2-4-10(8)11/h5H,1-4,6H2.
What are the key properties of 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride?
2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride has a molecular weight of 206.67 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride is sourced from PubChem (CID 155390015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).