C12H11ClO — CID 155390015
2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride (PubChem CID 155390015) has the molecular formula C12H11ClO and a molecular weight of 206.67 g/mol. Its IUPAC name is 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride.
| Compound Name | 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride |
|---|---|
| PubChem CID | 155390015 |
| Molecular Formula | C12H11ClO |
| Molecular Weight | 206.67 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-(2-tricyclo[6.2.0.03,6]deca-1(8),2,6-trienyl)acetyl chloride |
| SMILES | O=C(Cl)Cc1c2c(cc3c1CC3)CC2 |
| InChI | InChI=1S/C12H11ClO/c13-12(14)6-11-9-3-1-7(9)5-8-2-4-10(8)11/h5H,1-4,6H2 |
| InChIKey | VXPXHFRSWYCPCK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.67 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|